CAS 349-01-9 appears in our catalog under these names: 2,4–Dinitro–5–fluorotoluene, 1-Fluoro-5-methyl-2,4-dinitrobenzene 95%, 1-Fluoro-5-methyl-2,4-dinitrobenzene, 95%, 95%, 2,4-Dinitro-5-fluorotoluene, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
1-fluoro-5-methyl-2,4-dinitrobenzene (CAS 349-01-9) is a chemical compound with the molecular formula C7H5FN2O4 and a molecular weight of 200.12 g/mol. IUPAC name: 1-fluoro-5-methyl-2,4-dinitrobenzene. InChIKey: CMIMRMOSIVTUAA-UHFFFAOYSA-N.
| Molecular formula | C7H5FN2O4 |
|---|---|
| Molecular weight | 200.12 g/mol |
| IUPAC name | 1-fluoro-5-methyl-2,4-dinitrobenzene |
| InChIKey | CMIMRMOSIVTUAA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])F |
Computed by PubChem (NCBI)