CAS 101384-62-7 is the registry number for 1-Benzyl-5-chloro-2-oxo-1,2-dihydro-3-pyridinecarboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-benzyl-5-chloro-2-oxopyridine-3-carboxylic acid (CAS 101384-62-7) is a chemical compound with the molecular formula C13H10ClNO3 and a molecular weight of 263.67 g/mol. IUPAC name: 1-benzyl-5-chloro-2-oxopyridine-3-carboxylic acid. InChIKey: HPIOWOMSNUANFN-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO3 |
|---|---|
| Molecular weight | 263.67 g/mol |
| IUPAC name | 1-benzyl-5-chloro-2-oxopyridine-3-carboxylic acid |
| InChIKey | HPIOWOMSNUANFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C=C(C2=O)C(=O)O)Cl |
Computed by PubChem (NCBI)