CAS 76464-61-4 is the registry number for 2-(Benzyloxy)-1-chloro-4-nitrobenzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
1-chloro-4-nitro-2-phenylmethoxybenzene (CAS 76464-61-4) is a chemical compound with the molecular formula C13H10ClNO3 and a molecular weight of 263.67 g/mol. IUPAC name: 1-chloro-4-nitro-2-phenylmethoxybenzene. InChIKey: DXQRYHUPOMREGK-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO3 |
|---|---|
| Molecular weight | 263.67 g/mol |
| IUPAC name | 1-chloro-4-nitro-2-phenylmethoxybenzene |
| InChIKey | DXQRYHUPOMREGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)