Products 338754-68-0

CAS 338754-68-0 is the registry number for 1-(3-Chlorobenzyl)-2-oxo-1,2-dihydro-3-pyridinecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-[(3-chlorophenyl)methyl]-2-oxopyridine-3-carboxylic acid (CAS 338754-68-0) is a chemical compound with the molecular formula C13H10ClNO3 and a molecular weight of 263.67 g/mol. IUPAC name: 1-[(3-chlorophenyl)methyl]-2-oxopyridine-3-carboxylic acid. InChIKey: BYNRGIVNDGYPAO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10ClNO3
Molecular weight263.67 g/mol
IUPAC name1-[(3-chlorophenyl)methyl]-2-oxopyridine-3-carboxylic acid
InChIKeyBYNRGIVNDGYPAO-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Cl)CN2C=CC=C(C2=O)C(=O)O

Computed by PubChem (NCBI)