CAS 2120828-58-0 is the registry number for Methyl 6-(3-chlorophenyl)-2-oxo-1,2-dihydropyridine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 6-(3-chlorophenyl)-2-oxo-1H-pyridine-3-carboxylate (CAS 2120828-58-0) is a chemical compound with the molecular formula C13H10ClNO3 and a molecular weight of 263.67 g/mol. IUPAC name: methyl 6-(3-chlorophenyl)-2-oxo-1H-pyridine-3-carboxylate. InChIKey: KAIWMWSBAXEOEW-UHFFFAOYSA-N.
| Molecular formula | C13H10ClNO3 |
|---|---|
| Molecular weight | 263.67 g/mol |
| IUPAC name | methyl 6-(3-chlorophenyl)-2-oxo-1H-pyridine-3-carboxylate |
| InChIKey | KAIWMWSBAXEOEW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(NC1=O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)