CAS 1014-23-9 appears in our catalog under these names: 5–(4–Nitrophenyl)oxazole, 5-(4-Nitro-phenyl)-oxazole, 95%. Offered by: GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
5-(4-nitrophenyl)-1,3-oxazole (CAS 1014-23-9) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 5-(4-nitrophenyl)-1,3-oxazole. InChIKey: JJFHVOMPLSSUEC-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 5-(4-nitrophenyl)-1,3-oxazole |
| InChIKey | JJFHVOMPLSSUEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=CO2)[N+](=O)[O-] |
Computed by PubChem (NCBI)