CAS 1014629-59-4 is the registry number for (E)-4-(3-(Benzo[d][1,3]dioxol-5-yl)-3-oxoprop-1-en-1-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(E)-3-(1,3-benzodioxol-5-yl)-3-oxoprop-1-enyl]benzoic acid (CAS 1014629-59-4) is a chemical compound with the molecular formula C17H12O5 and a molecular weight of 296.27 g/mol. IUPAC name: 4-[(E)-3-(1,3-benzodioxol-5-yl)-3-oxoprop-1-enyl]benzoic acid. InChIKey: QSUBTJLDHQGITP-XVNBXDOJSA-N.
| Molecular formula | C17H12O5 |
|---|---|
| Molecular weight | 296.27 g/mol |
| IUPAC name | 4-[(E)-3-(1,3-benzodioxol-5-yl)-3-oxoprop-1-enyl]benzoic acid |
| InChIKey | QSUBTJLDHQGITP-XVNBXDOJSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(=O)/C=C/C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)