CAS 76530-89-7 is the registry number for 1,3-Bis(benzo[d][1,3]dioxol-5-yl)prop-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-1,3-bis(1,3-benzodioxol-5-yl)prop-2-en-1-one (CAS 76530-89-7) is a chemical compound with the molecular formula C17H12O5 and a molecular weight of 296.27 g/mol. IUPAC name: (E)-1,3-bis(1,3-benzodioxol-5-yl)prop-2-en-1-one. InChIKey: BJVBIPGXQAUWBA-DAFODLJHSA-N.
| Molecular formula | C17H12O5 |
|---|---|
| Molecular weight | 296.27 g/mol |
| IUPAC name | (E)-1,3-bis(1,3-benzodioxol-5-yl)prop-2-en-1-one |
| InChIKey | BJVBIPGXQAUWBA-DAFODLJHSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)/C=C/C(=O)C3=CC4=C(C=C3)OCO4 |
Computed by PubChem (NCBI)