CAS 68468-13-3 is the registry number for 7-Benzyl-5-carboxaldehyde-O-esculetin. Offered by: TRC. Available pack sizes: 100mg.
6-hydroxy-2-oxo-7-phenylmethoxychromene-5-carbaldehyde (CAS 68468-13-3) is a chemical compound with the molecular formula C17H12O5 and a molecular weight of 296.27 g/mol. IUPAC name: 6-hydroxy-2-oxo-7-phenylmethoxychromene-5-carbaldehyde. InChIKey: VHRGMDPQTBJXMC-UHFFFAOYSA-N.
| Molecular formula | C17H12O5 |
|---|---|
| Molecular weight | 296.27 g/mol |
| IUPAC name | 6-hydroxy-2-oxo-7-phenylmethoxychromene-5-carbaldehyde |
| InChIKey | VHRGMDPQTBJXMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C3C=CC(=O)OC3=C2)C=O)O |
Computed by PubChem (NCBI)