Products 130181-72-5

CAS 130181-72-5 is the registry number for [(2-Oxo-4-phenyl-2h-chromen-7-yl)oxy]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(2-oxo-4-phenylchromen-7-yl)oxyacetic acid (CAS 130181-72-5) is a chemical compound with the molecular formula C17H12O5 and a molecular weight of 296.27 g/mol. IUPAC name: 2-(2-oxo-4-phenylchromen-7-yl)oxyacetic acid. InChIKey: QOBLMSXUHNMBDB-UHFFFAOYSA-N.

Identity
Molecular formulaC17H12O5
Molecular weight296.27 g/mol
IUPAC name2-(2-oxo-4-phenylchromen-7-yl)oxyacetic acid
InChIKeyQOBLMSXUHNMBDB-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC(=O)OC3=C2C=CC(=C3)OCC(=O)O

Computed by PubChem (NCBI)