CAS 1014631-22-1 is the registry number for Methyl 2-(pyrazin-2-yl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-pyrazin-2-yl-1,3-thiazole-4-carboxylate (CAS 1014631-22-1) is a chemical compound with the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. IUPAC name: methyl 2-pyrazin-2-yl-1,3-thiazole-4-carboxylate. InChIKey: QNKODKZSKVJNMX-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2S |
|---|---|
| Molecular weight | 221.24 g/mol |
| IUPAC name | methyl 2-pyrazin-2-yl-1,3-thiazole-4-carboxylate |
| InChIKey | QNKODKZSKVJNMX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=NC=CN=C2 |
Computed by PubChem (NCBI)