CAS 1104276-29-0 appears in our catalog under these names: 4-Methyl-2-(pyrimidin-2-yl)-1,3-thiazole-5-carboxylic acid, 95%, 4-Methyl-2-(pyrimidin-2-yl)-1,3-thiazole-5-carboxylic acid, 4-Methyl-2-(2-pyrimidinyl)-5-thiazolecarboxylic acid, 98%, 98%, 4-methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 1g, 250mg, 0,5g, 500mg, 2.5g, 10g.
4-methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid (CAS 1104276-29-0) is a chemical compound with the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. IUPAC name: 4-methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid. InChIKey: LSOLFLCPKUKMAX-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2S |
|---|---|
| Molecular weight | 221.24 g/mol |
| IUPAC name | 4-methyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid |
| InChIKey | LSOLFLCPKUKMAX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=NC=CC=N2)C(=O)O |
Computed by PubChem (NCBI)