CAS 4447-43-2 is the registry number for 2-Hydroxy-N-(1,3,4-thiadiazol-2-yl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxy-N-(1,3,4-thiadiazol-2-yl)benzamide (CAS 4447-43-2) is a chemical compound with the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. IUPAC name: 2-hydroxy-N-(1,3,4-thiadiazol-2-yl)benzamide. InChIKey: KZUHYSRWKTWZBK-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2S |
|---|---|
| Molecular weight | 221.24 g/mol |
| IUPAC name | 2-hydroxy-N-(1,3,4-thiadiazol-2-yl)benzamide |
| InChIKey | KZUHYSRWKTWZBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=NN=CS2)O |
Computed by PubChem (NCBI)