CAS 1283108-40-6 appears in our catalog under these names: 2-(3-Pyridylamino)-1,3-thiazole-4-carboxylic acid, 95%, 2-((Pyridin-3-yl)amino)-1,3-thiazole-4-carboxylic acid, 95%, 2-(3-Pyridylamino)-1,3-thiazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 1000mg, 2000mg, 5000mg, 10000mg.
2-(pyridin-3-ylamino)-1,3-thiazole-4-carboxylic acid (CAS 1283108-40-6) is a chemical compound with the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. IUPAC name: 2-(pyridin-3-ylamino)-1,3-thiazole-4-carboxylic acid. InChIKey: DAVHHVODAQQKNH-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O2S |
|---|---|
| Molecular weight | 221.24 g/mol |
| IUPAC name | 2-(pyridin-3-ylamino)-1,3-thiazole-4-carboxylic acid |
| InChIKey | DAVHHVODAQQKNH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)NC2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)