CAS 1014644-95-1 appears in our catalog under these names: 4-[(1S)-1-[[(1,1-Dimethylethoxy)carbonyl]amino]ethyl]benzoic acid, 95%, 95%, (S)-4-(1-(tert-butoxycarbonyl)ethyl)benzoic acid, 95%, (S)-4-(1-((tert-Butoxycarbonyl)amino)ethyl)benzoic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid (CAS 1014644-95-1) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: 4-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid. InChIKey: OKRPFRUXMOYTDV-VIFPVBQESA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | 4-[(1S)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid |
| InChIKey | OKRPFRUXMOYTDV-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)