Products 101512-22-5

CAS 101512-22-5 is the registry number for Ethyl 5-benzamidonicotinate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl 5-benzamidopyridine-3-carboxylate (CAS 101512-22-5) is a chemical compound with the molecular formula C15H14N2O3 and a molecular weight of 270.28 g/mol. IUPAC name: ethyl 5-benzamidopyridine-3-carboxylate. InChIKey: MMUNFMWSFAMFRW-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14N2O3
Molecular weight270.28 g/mol
IUPAC nameethyl 5-benzamidopyridine-3-carboxylate
InChIKeyMMUNFMWSFAMFRW-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=CN=C1)NC(=O)C2=CC=CC=C2

Computed by PubChem (NCBI)