CAS 1015247-87-6 appears in our catalog under these names: (S)-2-(2-Chlorophenyl)-2-((2-(thiophen-2-yl)ethyl)amino)acetic acid, 98%, (S)-2-(2-Chlorophenyl)-2-((2-(thiophen-2-yl)ethyl)amino)acetic acid (Clopidogrel Impurity), 98%, 98%, Clopidogrel impurity 3, 98.55%, Clopidogrel impurity 3 (Standard). Offered by: AmBeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 1g, 100 mg, 250 mg, 1 g, 500 mg, Get quote, 250mg.
(2S)-2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)acetic acid (CAS 1015247-87-6) is a chemical compound with the molecular formula C14H14ClNO2S and a molecular weight of 295.8 g/mol. IUPAC name: (2S)-2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)acetic acid. InChIKey: LXVSWSGFEJYTPS-ZDUSSCGKSA-N.
| Molecular formula | C14H14ClNO2S |
|---|---|
| Molecular weight | 295.8 g/mol |
| IUPAC name | (2S)-2-(2-chlorophenyl)-2-(2-thiophen-2-ylethylamino)acetic acid |
| InChIKey | LXVSWSGFEJYTPS-ZDUSSCGKSA-N |
| SMILES | C1=CC=C(C(=C1)[C@@H](C(=O)O)NCCC2=CC=CS2)Cl |
Computed by PubChem (NCBI)