CAS 1015443-63-6 appears in our catalog under these names: (R)-4-(Pyrrolidin-3-yl)thiomorpholine 1,1-dioxide dihydrochloride, 97%, 97%, (R)-4-(PYRROLIDIN-3-YL)THIOMORPHOLINE 1,1-DIOXIDE DIHYDROCHLORIDE, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-[(3R)-pyrrolidin-3-yl]-1,4-thiazinane 1,1-dioxide;dihydrochloride (CAS 1015443-63-6) is a chemical compound with the molecular formula C8H18Cl2N2O2S and a molecular weight of 277.21 g/mol. IUPAC name: 4-[(3R)-pyrrolidin-3-yl]-1,4-thiazinane 1,1-dioxide;dihydrochloride. InChIKey: QLZYFIDOIRDQSE-YCBDHFTFSA-N.
| Molecular formula | C8H18Cl2N2O2S |
|---|---|
| Molecular weight | 277.21 g/mol |
| IUPAC name | 4-[(3R)-pyrrolidin-3-yl]-1,4-thiazinane 1,1-dioxide;dihydrochloride |
| InChIKey | QLZYFIDOIRDQSE-YCBDHFTFSA-N |
| SMILES | C1CNC[C@@H]1N2CCS(=O)(=O)CC2.Cl.Cl |
Computed by PubChem (NCBI)