Products 1821817-23-5

CAS 1821817-23-5 is the registry number for (S)-4-(Pyrrolidin-3-yl)thiomorpholine 1,1-dioxide dihydrochloride, 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-[(3S)-pyrrolidin-3-yl]-1,4-thiazinane 1,1-dioxide;dihydrochloride (CAS 1821817-23-5) is a chemical compound with the molecular formula C8H18Cl2N2O2S and a molecular weight of 277.21 g/mol. IUPAC name: 4-[(3S)-pyrrolidin-3-yl]-1,4-thiazinane 1,1-dioxide;dihydrochloride. InChIKey: QLZYFIDOIRDQSE-JZGIKJSDSA-N.

Identity
Molecular formulaC8H18Cl2N2O2S
Molecular weight277.21 g/mol
IUPAC name4-[(3S)-pyrrolidin-3-yl]-1,4-thiazinane 1,1-dioxide;dihydrochloride
InChIKeyQLZYFIDOIRDQSE-JZGIKJSDSA-N
SMILESC1CNC[C@H]1N2CCS(=O)(=O)CC2.Cl.Cl

Computed by PubChem (NCBI)