CAS 436852-26-5 appears in our catalog under these names: 1-(1,1-Dioxidotetrahydrothien-3-yl)piperazine dihydrochloride, 95%, 3-(Piperazin-1-yl)tetrahydrothiophene 1,1-dioxide dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g.
3-piperazin-1-ylthiolane 1,1-dioxide;dihydrochloride (CAS 436852-26-5) is a chemical compound with the molecular formula C8H18Cl2N2O2S and a molecular weight of 277.21 g/mol. IUPAC name: 3-piperazin-1-ylthiolane 1,1-dioxide;dihydrochloride. InChIKey: HQSKULSOPQPFDJ-UHFFFAOYSA-N.
| Molecular formula | C8H18Cl2N2O2S |
|---|---|
| Molecular weight | 277.21 g/mol |
| IUPAC name | 3-piperazin-1-ylthiolane 1,1-dioxide;dihydrochloride |
| InChIKey | HQSKULSOPQPFDJ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N2CCNCC2.Cl.Cl |
Computed by PubChem (NCBI)