CAS 2361635-36-9 is the registry number for 9-Imino-1-oxa-9λâ¶-thia-4-azaspiro(5.5)undecan-9-one dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
9-imino-1-oxa-9lambda6-thia-4-azaspiro[5.5]undecane 9-oxide;dihydrochloride (CAS 2361635-36-9) is a chemical compound with the molecular formula C8H18Cl2N2O2S and a molecular weight of 277.21 g/mol. IUPAC name: 9-imino-1-oxa-9lambda6-thia-4-azaspiro[5.5]undecane 9-oxide;dihydrochloride. InChIKey: IIKGZNKHBSAAFL-UHFFFAOYSA-N.
| Molecular formula | C8H18Cl2N2O2S |
|---|---|
| Molecular weight | 277.21 g/mol |
| IUPAC name | 9-imino-1-oxa-9lambda6-thia-4-azaspiro[5.5]undecane 9-oxide;dihydrochloride |
| InChIKey | IIKGZNKHBSAAFL-UHFFFAOYSA-N |
| SMILES | C1CS(=N)(=O)CCC12CNCCO2.Cl.Cl |
Computed by PubChem (NCBI)