CAS 101555-63-9 appears in our catalog under these names: Fmoc–D–Homopro–OH, Fmoc-D-Pip-OH, (R)-1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-2-piperidinecarboxylic Acid, >98.0%(HPLC)(T), Fmoc-D-HomoPro-OH 98%, (2R)-1-[[(9H-Fluoren-9-yl)methoxy]carbonyl]piperidine-2-carboxylic acid, 98%, 98%. Offered by: GLPBio, Iris Biotech, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 10g, 100g, 500g.
(2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-2-carboxylic acid (CAS 101555-63-9) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-2-carboxylic acid. InChIKey: CKLAZLINARHOTG-LJQANCHMSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-2-carboxylic acid |
| InChIKey | CKLAZLINARHOTG-LJQANCHMSA-N |
| SMILES | C1CCN([C@H](C1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)