CAS 86069-86-5 appears in our catalog under these names: Fmoc –β–HoPro–OH, Fmoc–β–Homo–Pro–OH, Fmoc-L-Pip-OH, N-Fmoc-L-pipecolic acid, 95% , (S)-1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-2-piperidinecarboxylic Acid, >98.0%(HPLC)(T). Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 1g, 5g, 100g, 25g, 1000g, 250mg, 10g, 500g.
(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-2-carboxylic acid (CAS 86069-86-5) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-2-carboxylic acid. InChIKey: CKLAZLINARHOTG-IBGZPJMESA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-2-carboxylic acid |
| InChIKey | CKLAZLINARHOTG-IBGZPJMESA-N |
| SMILES | C1CCN([C@@H](C1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)