CAS 1015938-81-4 appears in our catalog under these names: 6,8-Difluoro-2H-chromene, 95%, 6,8-Difluoro-2H-chromene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
6,8-difluoro-2H-chromene (CAS 1015938-81-4) is a chemical compound with the molecular formula C9H6F2O and a molecular weight of 168.14 g/mol. IUPAC name: 6,8-difluoro-2H-chromene. InChIKey: DRQKJKGKLYCHHB-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O |
|---|---|
| Molecular weight | 168.14 g/mol |
| IUPAC name | 6,8-difluoro-2H-chromene |
| InChIKey | DRQKJKGKLYCHHB-UHFFFAOYSA-N |
| SMILES | C1C=CC2=C(O1)C(=CC(=C2)F)F |
Computed by PubChem (NCBI)