CAS 101642-73-3 is the registry number for 2-Methyl-3-((2,2,2-trifluoroacetyl)amino)propanoic acid, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-methyl-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid (CAS 101642-73-3) is a chemical compound with the molecular formula C6H8F3NO3 and a molecular weight of 199.13 g/mol. IUPAC name: 2-methyl-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid. InChIKey: OQJANECZDICMRN-UHFFFAOYSA-N.
| Molecular formula | C6H8F3NO3 |
|---|---|
| Molecular weight | 199.13 g/mol |
| IUPAC name | 2-methyl-3-[(2,2,2-trifluoroacetyl)amino]propanoic acid |
| InChIKey | OQJANECZDICMRN-UHFFFAOYSA-N |
| SMILES | CC(CNC(=O)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)