CAS 1219000-15-3 is the registry number for 3-(2,2,2-Trifluoro-1,1-dihydroxyethyl)pyrrolidin-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,2,2-trifluoro-1,1-dihydroxyethyl)pyrrolidin-2-one (CAS 1219000-15-3) is a chemical compound with the molecular formula C6H8F3NO3 and a molecular weight of 199.13 g/mol. IUPAC name: 3-(2,2,2-trifluoro-1,1-dihydroxyethyl)pyrrolidin-2-one. InChIKey: LXAWJDAQLVJKMU-UHFFFAOYSA-N.
| Molecular formula | C6H8F3NO3 |
|---|---|
| Molecular weight | 199.13 g/mol |
| IUPAC name | 3-(2,2,2-trifluoro-1,1-dihydroxyethyl)pyrrolidin-2-one |
| InChIKey | LXAWJDAQLVJKMU-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C1C(C(F)(F)F)(O)O |
Computed by PubChem (NCBI)