Products 1396996-17-0

CAS 1396996-17-0 is the registry number for 2-(3,3,3-Trifluoropropanamido)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-(3,3,3-trifluoropropanoylamino)propanoic acid (CAS 1396996-17-0) is a chemical compound with the molecular formula C6H8F3NO3 and a molecular weight of 199.13 g/mol. IUPAC name: 2-(3,3,3-trifluoropropanoylamino)propanoic acid. InChIKey: QMMJDJSJEGCIIM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8F3NO3
Molecular weight199.13 g/mol
IUPAC name2-(3,3,3-trifluoropropanoylamino)propanoic acid
InChIKeyQMMJDJSJEGCIIM-UHFFFAOYSA-N
SMILESCC(C(=O)O)NC(=O)CC(F)(F)F

Computed by PubChem (NCBI)