CAS 1396996-17-0 is the registry number for 2-(3,3,3-Trifluoropropanamido)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(3,3,3-trifluoropropanoylamino)propanoic acid (CAS 1396996-17-0) is a chemical compound with the molecular formula C6H8F3NO3 and a molecular weight of 199.13 g/mol. IUPAC name: 2-(3,3,3-trifluoropropanoylamino)propanoic acid. InChIKey: QMMJDJSJEGCIIM-UHFFFAOYSA-N.
| Molecular formula | C6H8F3NO3 |
|---|---|
| Molecular weight | 199.13 g/mol |
| IUPAC name | 2-(3,3,3-trifluoropropanoylamino)propanoic acid |
| InChIKey | QMMJDJSJEGCIIM-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC(=O)CC(F)(F)F |
Computed by PubChem (NCBI)