CAS 1016510-22-7 appears in our catalog under these names: 2-({((3-nitrophenyl)methyl)carbamoyl}amino)acetic acid, 95%, 2-({((3-Nitrophenyl)methyl)carbamoyl}amino)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-[(3-nitrophenyl)methylcarbamoylamino]acetic acid (CAS 1016510-22-7) is a chemical compound with the molecular formula C10H11N3O5 and a molecular weight of 253.21 g/mol. IUPAC name: 2-[(3-nitrophenyl)methylcarbamoylamino]acetic acid. InChIKey: OCNZMRAHAMDZJD-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O5 |
|---|---|
| Molecular weight | 253.21 g/mol |
| IUPAC name | 2-[(3-nitrophenyl)methylcarbamoylamino]acetic acid |
| InChIKey | OCNZMRAHAMDZJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])CNC(=O)NCC(=O)O |
Computed by PubChem (NCBI)