Products 688334-02-3

CAS 688334-02-3 is the registry number for N-([(4-Nitrophenyl)amino]carbonyl)alanine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(4-nitrophenyl)carbamoylamino]propanoic acid (CAS 688334-02-3) is a chemical compound with the molecular formula C10H11N3O5 and a molecular weight of 253.21 g/mol. IUPAC name: 2-[(4-nitrophenyl)carbamoylamino]propanoic acid. InChIKey: AGHYCQKOMGHZNX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11N3O5
Molecular weight253.21 g/mol
IUPAC name2-[(4-nitrophenyl)carbamoylamino]propanoic acid
InChIKeyAGHYCQKOMGHZNX-UHFFFAOYSA-N
SMILESCC(C(=O)O)NC(=O)NC1=CC=C(C=C1)[N+](=O)[O-]

Computed by PubChem (NCBI)