CAS 39242-76-7 is the registry number for 4-(2,4-Dinitrophenyl)morpholine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(2,4-dinitrophenyl)morpholine (CAS 39242-76-7) is a chemical compound with the molecular formula C10H11N3O5 and a molecular weight of 253.21 g/mol. IUPAC name: 4-(2,4-dinitrophenyl)morpholine. InChIKey: SNONFGXPIHDLRG-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O5 |
|---|---|
| Molecular weight | 253.21 g/mol |
| IUPAC name | 4-(2,4-dinitrophenyl)morpholine |
| InChIKey | SNONFGXPIHDLRG-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)