CAS 1040320-73-7 is the registry number for 2-{methyl((3-nitrophenyl)carbamoyl)amino}acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[methyl-[(3-nitrophenyl)carbamoyl]amino]acetic acid (CAS 1040320-73-7) is a chemical compound with the molecular formula C10H11N3O5 and a molecular weight of 253.21 g/mol. IUPAC name: 2-[methyl-[(3-nitrophenyl)carbamoyl]amino]acetic acid. InChIKey: YEUCYFFHFOXFMJ-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O5 |
|---|---|
| Molecular weight | 253.21 g/mol |
| IUPAC name | 2-[methyl-[(3-nitrophenyl)carbamoyl]amino]acetic acid |
| InChIKey | YEUCYFFHFOXFMJ-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C(=O)NC1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)