Products 1016515-84-6
CAS 1016515-84-6 is the registry number for 1-(3-Chloropyridin-2-yl)piperidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1-(3-chloro-2-pyridinyl)piperidine-3-carboxylic acid (CAS 1016515-84-6) is a chemical compound with the molecular formula C11H13ClN2O2 and a molecular weight of 240.68 g/mol. IUPAC name: 1-(3-chloro-2-pyridinyl)piperidine-3-carboxylic acid. InChIKey: SNIJJDOFXHTRLC-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O2 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | 1-(3-chloro-2-pyridinyl)piperidine-3-carboxylic acid |
| InChIKey | SNIJJDOFXHTRLC-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=C(C=CC=N2)Cl)C(=O)O |
Computed by PubChem (NCBI)