CAS 1016521-21-3 is the registry number for 6-Methanesulfonyl-1,2,3,4-tetrahydroquinoline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6-methylsulfonyl-1,2,3,4-tetrahydroquinoline (CAS 1016521-21-3) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: 6-methylsulfonyl-1,2,3,4-tetrahydroquinoline. InChIKey: FBCGZNQGQDPYAH-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 6-methylsulfonyl-1,2,3,4-tetrahydroquinoline |
| InChIKey | FBCGZNQGQDPYAH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)NCCC2 |
Computed by PubChem (NCBI)