Products 1016528-42-9
CAS 1016528-42-9 appears in our catalog under these names: 5-(3,4-Dimethylphenyl)-1,3,4-oxadiazol-2-amine, 98%, 5-(3,4-Dimethylphenyl)-1,3,4-oxadiazol-2-amine, 97%. Offered by: Combi-blocks, Ambeed, BLDpharm. Available pack sizes: 5g, 1g, 250mg.
5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-amine (CAS 1016528-42-9) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: 5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-amine. InChIKey: NAONXQCGDDBKBD-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | NAONXQCGDDBKBD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NN=C(O2)N)C |
Computed by PubChem (NCBI)