Products 1016535-37-7
CAS 1016535-37-7 is the registry number for 3-Methyl-5-(2-phenoxyacetamido)thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-methyl-5-[(2-phenoxyacetyl)amino]thiophene-2-carboxylic acid (CAS 1016535-37-7) is a chemical compound with the molecular formula C14H13NO4S and a molecular weight of 291.32 g/mol. IUPAC name: 3-methyl-5-[(2-phenoxyacetyl)amino]thiophene-2-carboxylic acid. InChIKey: AQFQTLPZZODVQE-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4S |
|---|---|
| Molecular weight | 291.32 g/mol |
| IUPAC name | 3-methyl-5-[(2-phenoxyacetyl)amino]thiophene-2-carboxylic acid |
| InChIKey | AQFQTLPZZODVQE-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1)NC(=O)COC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)