CAS 1016675-85-6 appears in our catalog under these names: 3-(2,3-Dihydro-1H-inden-5-yl)-1H-1,2,4-triazol-5-amine, 95%, 3-(2,3-Dihydro-1H-inden-5-yl)-1H-1,2,4-triazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
5-(2,3-dihydro-1H-inden-5-yl)-1H-1,2,4-triazol-3-amine (CAS 1016675-85-6) is a chemical compound with the molecular formula C11H12N4 and a molecular weight of 200.24 g/mol. IUPAC name: 5-(2,3-dihydro-1H-inden-5-yl)-1H-1,2,4-triazol-3-amine. InChIKey: JQFPEDNNJFIGRA-UHFFFAOYSA-N.
| Molecular formula | C11H12N4 |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | 5-(2,3-dihydro-1H-inden-5-yl)-1H-1,2,4-triazol-3-amine |
| InChIKey | JQFPEDNNJFIGRA-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)C3=NC(=NN3)N |
Computed by PubChem (NCBI)