CAS 1016676-05-3 is the registry number for 4-(Cyclopropylcarbamoyl)benzene-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(cyclopropylcarbamoyl)benzenesulfonyl chloride (CAS 1016676-05-3) is a chemical compound with the molecular formula C10H10ClNO3S and a molecular weight of 259.71 g/mol. IUPAC name: 4-(cyclopropylcarbamoyl)benzenesulfonyl chloride. InChIKey: LZXIZCNYHOOLKX-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO3S |
|---|---|
| Molecular weight | 259.71 g/mol |
| IUPAC name | 4-(cyclopropylcarbamoyl)benzenesulfonyl chloride |
| InChIKey | LZXIZCNYHOOLKX-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)