Products 313690-18-5
CAS 313690-18-5 appears in our catalog under these names: 1-Acetyl-2,3-dihydro-1h-indole-6-sulfonyl chloride, 95%, 1-Acetylindoline-6-sulfonyl chloride, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
1-acetyl-2,3-dihydroindole-6-sulfonyl chloride (CAS 313690-18-5) is a chemical compound with the molecular formula C10H10ClNO3S and a molecular weight of 259.71 g/mol. IUPAC name: 1-acetyl-2,3-dihydroindole-6-sulfonyl chloride. InChIKey: FTWAILLGJAETPR-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO3S |
|---|---|
| Molecular weight | 259.71 g/mol |
| IUPAC name | 1-acetyl-2,3-dihydroindole-6-sulfonyl chloride |
| InChIKey | FTWAILLGJAETPR-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C1C=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)