Products 131880-56-3

CAS 131880-56-3 is the registry number for 3,3-Dimethyl-2-oxo-2,3-dihydro-1h-indole-5-sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3,3-dimethyl-2-oxo-1H-indole-5-sulfonyl chloride (CAS 131880-56-3) is a chemical compound with the molecular formula C10H10ClNO3S and a molecular weight of 259.71 g/mol. IUPAC name: 3,3-dimethyl-2-oxo-1H-indole-5-sulfonyl chloride. InChIKey: ZSQGKDCXTIYZSF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10ClNO3S
Molecular weight259.71 g/mol
IUPAC name3,3-dimethyl-2-oxo-1H-indole-5-sulfonyl chloride
InChIKeyZSQGKDCXTIYZSF-UHFFFAOYSA-N
SMILESCC1(C2=C(C=CC(=C2)S(=O)(=O)Cl)NC1=O)C

Computed by PubChem (NCBI)