Products 1343869-66-8
CAS 1343869-66-8 is the registry number for 1-(((5-Chlorothiophen-2-yl)methyl)carbamoyl)cyclopropane-1-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(5-chlorothiophen-2-yl)methylcarbamoyl]cyclopropane-1-carboxylic acid (CAS 1343869-66-8) is a chemical compound with the molecular formula C10H10ClNO3S and a molecular weight of 259.71 g/mol. IUPAC name: 1-[(5-chlorothiophen-2-yl)methylcarbamoyl]cyclopropane-1-carboxylic acid. InChIKey: BSIVVCBDFALJFW-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO3S |
|---|---|
| Molecular weight | 259.71 g/mol |
| IUPAC name | 1-[(5-chlorothiophen-2-yl)methylcarbamoyl]cyclopropane-1-carboxylic acid |
| InChIKey | BSIVVCBDFALJFW-UHFFFAOYSA-N |
| SMILES | C1CC1(C(=O)NCC2=CC=C(S2)Cl)C(=O)O |
Computed by PubChem (NCBI)