Products 1016686-46-6
CAS 1016686-46-6 appears in our catalog under these names: 5-(5-Chloro-2-methoxyphenyl)-1,3,4-oxadiazol-2-amine, 95%, 5-(5-Chloro-2-methoxyphenyl)-1,3,4-oxadiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
5-(5-chloro-2-methoxyphenyl)-1,3,4-oxadiazol-2-amine (CAS 1016686-46-6) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: 5-(5-chloro-2-methoxyphenyl)-1,3,4-oxadiazol-2-amine. InChIKey: CMKALBAFLIKUDV-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | 5-(5-chloro-2-methoxyphenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | CMKALBAFLIKUDV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)C2=NN=C(O2)N |
Computed by PubChem (NCBI)