Products 1016689-54-5
CAS 1016689-54-5 is the registry number for 2-(3-Carbamoyl-1H-indol-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(3-carbamoylindol-1-yl)acetic acid (CAS 1016689-54-5) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 2-(3-carbamoylindol-1-yl)acetic acid. InChIKey: SGHBCZQKOOSRRQ-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 2-(3-carbamoylindol-1-yl)acetic acid |
| InChIKey | SGHBCZQKOOSRRQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2CC(=O)O)C(=O)N |
Computed by PubChem (NCBI)