CAS 1016708-69-2 is the registry number for N-(3-Bromophenyl)-4-methylthiazole-5-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-bromophenyl)-4-methyl-1,3-thiazole-5-carboxamide (CAS 1016708-69-2) is a chemical compound with the molecular formula C11H9BrN2OS and a molecular weight of 297.17 g/mol. IUPAC name: N-(3-bromophenyl)-4-methyl-1,3-thiazole-5-carboxamide. InChIKey: WQSLPASFIVVPRR-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2OS |
|---|---|
| Molecular weight | 297.17 g/mol |
| IUPAC name | N-(3-bromophenyl)-4-methyl-1,3-thiazole-5-carboxamide |
| InChIKey | WQSLPASFIVVPRR-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=N1)C(=O)NC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)