CAS 302967-87-9 is the registry number for 4-Bromo-n-(4-methyl-1,3-thiazol-2-yl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-bromo-N-(4-methyl-1,3-thiazol-2-yl)benzamide (CAS 302967-87-9) is a chemical compound with the molecular formula C11H9BrN2OS and a molecular weight of 297.17 g/mol. IUPAC name: 4-bromo-N-(4-methyl-1,3-thiazol-2-yl)benzamide. InChIKey: YXUNUMNYOKSUJQ-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2OS |
|---|---|
| Molecular weight | 297.17 g/mol |
| IUPAC name | 4-bromo-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
| InChIKey | YXUNUMNYOKSUJQ-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)NC(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)