CAS 925394-14-5 is the registry number for 2-Bromo-N-(5-methylthiazol-2-yl)benzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-N-(5-methyl-1,3-thiazol-2-yl)benzamide (CAS 925394-14-5) is a chemical compound with the molecular formula C11H9BrN2OS and a molecular weight of 297.17 g/mol. IUPAC name: 2-bromo-N-(5-methyl-1,3-thiazol-2-yl)benzamide. InChIKey: JZMMUEFVXFWJRJ-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2OS |
|---|---|
| Molecular weight | 297.17 g/mol |
| IUPAC name | 2-bromo-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| InChIKey | JZMMUEFVXFWJRJ-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(S1)NC(=O)C2=CC=CC=C2Br |
Computed by PubChem (NCBI)