Products 1468774-80-2
CAS 1468774-80-2 is the registry number for 5-Bromo-n-(2-methylpyridin-4-yl)thiophene-2-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
5-bromo-N-(2-methyl-4-pyridinyl)thiophene-2-carboxamide (CAS 1468774-80-2) is a chemical compound with the molecular formula C11H9BrN2OS and a molecular weight of 297.17 g/mol. IUPAC name: 5-bromo-N-(2-methyl-4-pyridinyl)thiophene-2-carboxamide. InChIKey: VVJUYTVZYVHIBB-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2OS |
|---|---|
| Molecular weight | 297.17 g/mol |
| IUPAC name | 5-bromo-N-(2-methyl-4-pyridinyl)thiophene-2-carboxamide |
| InChIKey | VVJUYTVZYVHIBB-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC(=C1)NC(=O)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)