CAS 1016734-75-0 is the registry number for 4-((3-Aminophenyl)methyl)piperazin-2-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-[(3-aminophenyl)methyl]piperazin-2-one (CAS 1016734-75-0) is a chemical compound with the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. IUPAC name: 4-[(3-aminophenyl)methyl]piperazin-2-one. InChIKey: PXSLZAJVQONFLC-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O |
|---|---|
| Molecular weight | 205.26 g/mol |
| IUPAC name | 4-[(3-aminophenyl)methyl]piperazin-2-one |
| InChIKey | PXSLZAJVQONFLC-UHFFFAOYSA-N |
| SMILES | C1CN(CC(=O)N1)CC2=CC(=CC=C2)N |
Computed by PubChem (NCBI)