CAS 1016749-41-9 is the registry number for 3-(1,1-Dioxo-1,2-thiazolidin-2-yl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(1,1-dioxo-1,2-thiazolidin-2-yl)propanoic acid (CAS 1016749-41-9) is a chemical compound with the molecular formula C6H11NO4S and a molecular weight of 193.22 g/mol. IUPAC name: 3-(1,1-dioxo-1,2-thiazolidin-2-yl)propanoic acid. InChIKey: FHGSRJMDQOUNQL-UHFFFAOYSA-N.
| Molecular formula | C6H11NO4S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)propanoic acid |
| InChIKey | FHGSRJMDQOUNQL-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)CCC(=O)O |
Computed by PubChem (NCBI)