Products 1218504-97-2

CAS 1218504-97-2 appears in our catalog under these names: 2-Amino-2-(1,1-dioxo-1lambda6-thiolan-3-yl)acetic acid, 95%, α-​Aminotetrahydro-3-​thiopheneacetic acid 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-amino-2-(1,1-dioxothiolan-3-yl)acetic acid (CAS 1218504-97-2) is a chemical compound with the molecular formula C6H11NO4S and a molecular weight of 193.22 g/mol. IUPAC name: 2-amino-2-(1,1-dioxothiolan-3-yl)acetic acid. InChIKey: PNUCQEVTIYHOEJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11NO4S
Molecular weight193.22 g/mol
IUPAC name2-amino-2-(1,1-dioxothiolan-3-yl)acetic acid
InChIKeyPNUCQEVTIYHOEJ-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC1C(C(=O)O)N

Computed by PubChem (NCBI)