Products 1016771-98-4
CAS 1016771-98-4 is the registry number for 5-Bromo-1-cyclopentyl-1H-pyrazolo(3,4-b)pyridine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-bromo-1-cyclopentylpyrazolo[3,4-b]pyridine (CAS 1016771-98-4) is a chemical compound with the molecular formula C11H12BrN3 and a molecular weight of 266.14 g/mol. IUPAC name: 5-bromo-1-cyclopentylpyrazolo[3,4-b]pyridine. InChIKey: YJUGUHQZCVJXFL-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN3 |
|---|---|
| Molecular weight | 266.14 g/mol |
| IUPAC name | 5-bromo-1-cyclopentylpyrazolo[3,4-b]pyridine |
| InChIKey | YJUGUHQZCVJXFL-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C3=NC=C(C=C3C=N2)Br |
Computed by PubChem (NCBI)